C26H19AsN2O2 — CID 87256779
CID 87256779 (PubChem CID 87256779) has the molecular formula C26H19AsN2O2 and a molecular weight of 466.37 g/mol.
| Compound Name | CID 87256779 |
|---|---|
| PubChem CID | 87256779 |
| Molecular Formula | C26H19AsN2O2 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | — |
| SMILES | O=c1c(-c2ccc(C3([As])CCC3)cc2)c(-c2ccccc2)oc2c1ccc1[nH]cnc12 |
| InChI | InChI=1S/C26H19AsN2O2/c27-26(13-4-14-26)18-9-7-16(8-10-18)21-23(30)19-11-12-20-22(29-15-28-20)25(19)31-24(21)17-5-2-1-3-6-17/h1-3,5-12,15H,4,13-14H2,(H,28,29) |
| InChIKey | RXCYDPVYQVWAGL-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|