C34H8F10N4 — CID 51032293
7,18-bis(2,3,4,5,6-pentafluorophenyl)-6,8,17,19-tetrazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1,3(12),4,6,8,10,13(23),14,16,18,20(24),21,25-tridecaene (PubChem CID 51032293) has the molecular formula C34H8F10N4 and a molecular weight of 662.45 g/mol. Its IUPAC name is 7,18-bis(2,3,4,5,6-pentafluorophenyl)-6,8,17,19-tetrazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1,3(12),4,6,8,10,13(23),14,16,18,20(24),21,25-tridecaene.
| Compound Name | 7,18-bis(2,3,4,5,6-pentafluorophenyl)-6,8,17,19-tetrazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1,3(12),4,6,8,10,13(23),14,16,18,20(24),21,25-tridecaene |
|---|---|
| PubChem CID | 51032293 |
| Molecular Formula | C34H8F10N4 |
| Molecular Weight | 662.45 g/mol |
| Exact Mass | 662.06 |
| IUPAC Name | 7,18-bis(2,3,4,5,6-pentafluorophenyl)-6,8,17,19-tetrazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1,3(12),4,6,8,10,13(23),14,16,18,20(24),21,25-tridecaene |
| SMILES | Fc1c(F)c(F)c(-c2nc3ccc4c5ccc6nc(-c7c(F)c(F)c(F)c(F)c7F)nc7ccc(c8ccc(n2)c3c48)c5c67)c(F)c1F |
| InChI | InChI=1S/C34H8F10N4/c35-23-21(24(36)28(40)31(43)27(23)39)33-45-13-5-1-9-10-2-6-15-20-16(48-34(47-15)22-25(37)29(41)32(44)30(42)26(22)38)8-4-12(18(10)20)11-3-7-14(46-33)19(13)17(9)11/h1-8H |
| InChIKey | XEAPQJXUZADHCL-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.45 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|