C43H39ClFN3O5 — CID 5103282
2-(1-benzylpiperidin-4-yl)-8-(3-chloro-4-fluorophenyl)-6-(4-hydroxynaphthalen-1-yl)-6a-methyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5103282) has the molecular formula C43H39ClFN3O5 and a molecular weight of 732.25 g/mol. Its IUPAC name is 2-(1-benzylpiperidin-4-yl)-8-(3-chloro-4-fluorophenyl)-6-(4-hydroxynaphthalen-1-yl)-6a-methyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(1-benzylpiperidin-4-yl)-8-(3-chloro-4-fluorophenyl)-6-(4-hydroxynaphthalen-1-yl)-6a-methyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5103282 |
| Molecular Formula | C43H39ClFN3O5 |
| Molecular Weight | 732.25 g/mol |
| Exact Mass | 731.26 |
| IUPAC Name | 2-(1-benzylpiperidin-4-yl)-8-(3-chloro-4-fluorophenyl)-6-(4-hydroxynaphthalen-1-yl)-6a-methyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CC12C(=O)N(c3ccc(F)c(Cl)c3)C(=O)C1CC1C(=CCC3C(=O)N(C4CCN(Cc5ccccc5)CC4)C(=O)C31)C2c1ccc(O)c2ccccc12 |
| InChI | InChI=1S/C43H39ClFN3O5/c1-43-33(40(51)48(42(43)53)26-11-15-35(45)34(44)21-26)22-32-30(38(43)29-14-16-36(49)28-10-6-5-9-27(28)29)12-13-31-37(32)41(52)47(39(31)50)25-17-19-46(20-18-25)23-24-7-3-2-4-8-24/h2-12,14-16,21,25,31-33,37-38,49H,13,17-20,22-23H2,1H3 |
| InChIKey | CCTNIPBFNXYAFF-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.25 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|