C25H19ClINO5 — CID 51033545
3-chloro-2-(3-iodo-4-phenylmethoxyphenyl)-3-nitro-8-prop-2-enyl-2H-chromen-4-one (PubChem CID 51033545) has the molecular formula C25H19ClINO5 and a molecular weight of 575.79 g/mol. Its IUPAC name is 3-chloro-2-(3-iodo-4-phenylmethoxyphenyl)-3-nitro-8-prop-2-enyl-2H-chromen-4-one.
| Compound Name | 3-chloro-2-(3-iodo-4-phenylmethoxyphenyl)-3-nitro-8-prop-2-enyl-2H-chromen-4-one |
|---|---|
| PubChem CID | 51033545 |
| Molecular Formula | C25H19ClINO5 |
| Molecular Weight | 575.79 g/mol |
| Exact Mass | 575.00 |
| IUPAC Name | 3-chloro-2-(3-iodo-4-phenylmethoxyphenyl)-3-nitro-8-prop-2-enyl-2H-chromen-4-one |
| SMILES | C=CCc1cccc2c1OC(c1ccc(OCc3ccccc3)c(I)c1)C(Cl)([N+](=O)[O-])C2=O |
| InChI | InChI=1S/C25H19ClINO5/c1-2-7-17-10-6-11-19-22(17)33-24(25(26,23(19)29)28(30)31)18-12-13-21(20(27)14-18)32-15-16-8-4-3-5-9-16/h2-6,8-14,24H,1,7,15H2 |
| InChIKey | YLLFFWGGCIAOIT-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.79 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|