C18H13F4N5O — CID 51033790
3-fluoro-5-[methyl(pyrimidin-5-yl)amino]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide (PubChem CID 51033790) has the molecular formula C18H13F4N5O and a molecular weight of 391.33 g/mol. Its IUPAC name is 3-fluoro-5-[methyl(pyrimidin-5-yl)amino]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide.
| Compound Name | 3-fluoro-5-[methyl(pyrimidin-5-yl)amino]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 51033790 |
| Molecular Formula | C18H13F4N5O |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 3-fluoro-5-[methyl(pyrimidin-5-yl)amino]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
| SMILES | CN(c1cncnc1)c1cc(F)cc(C(=O)Nc2cc(C(F)(F)F)ccn2)c1 |
| InChI | InChI=1S/C18H13F4N5O/c1-27(15-8-23-10-24-9-15)14-5-11(4-13(19)7-14)17(28)26-16-6-12(2-3-25-16)18(20,21)22/h2-10H,1H3,(H,25,26,28) |
| InChIKey | RZBOWEAEQMTKMQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |