C10H8F3NO — CID 51034129
N-[1-(2,4,6-trifluorophenyl)ethenyl]acetamide (PubChem CID 51034129) has the molecular formula C10H8F3NO and a molecular weight of 215.17 g/mol. Its IUPAC name is N-[1-(2,4,6-trifluorophenyl)ethenyl]acetamide.
| Compound Name | N-[1-(2,4,6-trifluorophenyl)ethenyl]acetamide |
|---|---|
| PubChem CID | 51034129 |
| Molecular Formula | C10H8F3NO |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | N-[1-(2,4,6-trifluorophenyl)ethenyl]acetamide |
| SMILES | C=C(NC(C)=O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C10H8F3NO/c1-5(14-6(2)15)10-8(12)3-7(11)4-9(10)13/h3-4H,1H2,2H3,(H,14,15) |
| InChIKey | UUKYZWXASUJRMC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |