C9H6F3NO — CID 142441728
2-(2,4,6-trifluorophenyl)prop-2-enamide (PubChem CID 142441728) has the molecular formula C9H6F3NO and a molecular weight of 201.15 g/mol. Its IUPAC name is 2-(2,4,6-trifluorophenyl)prop-2-enamide.
| Compound Name | 2-(2,4,6-trifluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 142441728 |
| Molecular Formula | C9H6F3NO |
| Molecular Weight | 201.15 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 2-(2,4,6-trifluorophenyl)prop-2-enamide |
| SMILES | C=C(C(N)=O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C9H6F3NO/c1-4(9(13)14)8-6(11)2-5(10)3-7(8)12/h2-3H,1H2,(H2,13,14) |
| InChIKey | LZYRQYWZWWVBBO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.15 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|