About 1-ethenyl-3,5-difluoro-2-(1-fluoroethenyl)benzene
1-ethenyl-3,5-difluoro-2-(1-fluoroethenyl)benzene (PubChem CID 142394213) has the molecular formula C10H7F3
and a molecular weight of 184.16 g/mol. Its IUPAC name is 1-ethenyl-3,5-difluoro-2-(1-fluoroethenyl)benzene.
Analyze 1-ethenyl-3,5-difluoro-2-(1-fluoroethenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-3,5-difluoro-2-(1-fluoroethenyl)benzene?
The IUPAC name of 1-ethenyl-3,5-difluoro-2-(1-fluoroethenyl)benzene (CID 142394213) is 1-ethenyl-3,5-difluoro-2-(1-fluoroethenyl)benzene.
What is the SMILES notation for 1-ethenyl-3,5-difluoro-2-(1-fluoroethenyl)benzene?
The canonical SMILES for 1-ethenyl-3,5-difluoro-2-(1-fluoroethenyl)benzene is C=Cc1cc(F)cc(F)c1C(=C)F.
What is the InChIKey of 1-ethenyl-3,5-difluoro-2-(1-fluoroethenyl)benzene?
The InChIKey is SWESBMJQOFQLJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F3/c1-3-7-4-8(12)5-9(13)10(7)6(2)11/h3-5H,1-2H2.
What are the key properties of 1-ethenyl-3,5-difluoro-2-(1-fluoroethenyl)benzene?
1-ethenyl-3,5-difluoro-2-(1-fluoroethenyl)benzene has a molecular weight of 184.16 g/mol, XLogP of 3.55, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-3,5-difluoro-2-(1-fluoroethenyl)benzene is sourced from PubChem (CID 142394213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).