C14H16FN — CID 166919340
3-ethenyl-5-fluoro-4-[(3E)-hexa-1,3-dien-3-yl]aniline (PubChem CID 166919340) has the molecular formula C14H16FN and a molecular weight of 217.29 g/mol. Its IUPAC name is 3-ethenyl-5-fluoro-4-[(3E)-hexa-1,3-dien-3-yl]aniline.
| Compound Name | 3-ethenyl-5-fluoro-4-[(3E)-hexa-1,3-dien-3-yl]aniline |
|---|---|
| PubChem CID | 166919340 |
| Molecular Formula | C14H16FN |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 3-ethenyl-5-fluoro-4-[(3E)-hexa-1,3-dien-3-yl]aniline |
| SMILES | C=C/C(=C\CC)c1c(F)cc(N)cc1C=C |
| InChI | InChI=1S/C14H16FN/c1-4-7-10(5-2)14-11(6-3)8-12(16)9-13(14)15/h5-9H,2-4,16H2,1H3/b10-7+ |
| InChIKey | SRHQRCRYDVBPCX-JXMROGBWSA-N |
| XLogP | 4.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|