About 1,5-difluoro-2,3-bis(1,2,2-trifluoroethenyl)benzene
1,5-difluoro-2,3-bis(1,2,2-trifluoroethenyl)benzene (PubChem CID 134401266) has the molecular formula C10H2F8
and a molecular weight of 274.11 g/mol. Its IUPAC name is 1,5-difluoro-2,3-bis(1,2,2-trifluoroethenyl)benzene.
Analyze 1,5-difluoro-2,3-bis(1,2,2-trifluoroethenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-difluoro-2,3-bis(1,2,2-trifluoroethenyl)benzene?
The IUPAC name of 1,5-difluoro-2,3-bis(1,2,2-trifluoroethenyl)benzene (CID 134401266) is 1,5-difluoro-2,3-bis(1,2,2-trifluoroethenyl)benzene.
What is the SMILES notation for 1,5-difluoro-2,3-bis(1,2,2-trifluoroethenyl)benzene?
The canonical SMILES for 1,5-difluoro-2,3-bis(1,2,2-trifluoroethenyl)benzene is FC(F)=C(F)c1cc(F)cc(F)c1C(F)=C(F)F.
What is the InChIKey of 1,5-difluoro-2,3-bis(1,2,2-trifluoroethenyl)benzene?
The InChIKey is DEFFQPKWVFNOCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H2F8/c11-3-1-4(7(13)9(15)16)6(5(12)2-3)8(14)10(17)18/h1-2H.
What are the key properties of 1,5-difluoro-2,3-bis(1,2,2-trifluoroethenyl)benzene?
1,5-difluoro-2,3-bis(1,2,2-trifluoroethenyl)benzene has a molecular weight of 274.11 g/mol, XLogP of 5.03, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-difluoro-2,3-bis(1,2,2-trifluoroethenyl)benzene is sourced from PubChem (CID 134401266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).