C21H16F4O4 — CID 175151149
2-[4-[2-[4-(1-carboxyethenyl)-3,5-difluorophenyl]propan-2-yl]-2,6-difluorophenyl]prop-2-enoic acid (PubChem CID 175151149) has the molecular formula C21H16F4O4 and a molecular weight of 408.35 g/mol. Its IUPAC name is 2-[4-[2-[4-(1-carboxyethenyl)-3,5-difluorophenyl]propan-2-yl]-2,6-difluorophenyl]prop-2-enoic acid.
| Compound Name | 2-[4-[2-[4-(1-carboxyethenyl)-3,5-difluorophenyl]propan-2-yl]-2,6-difluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 175151149 |
| Molecular Formula | C21H16F4O4 |
| Molecular Weight | 408.35 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 2-[4-[2-[4-(1-carboxyethenyl)-3,5-difluorophenyl]propan-2-yl]-2,6-difluorophenyl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)c1c(F)cc(C(C)(C)c2cc(F)c(C(=C)C(=O)O)c(F)c2)cc1F |
| InChI | InChI=1S/C21H16F4O4/c1-9(19(26)27)17-13(22)5-11(6-14(17)23)21(3,4)12-7-15(24)18(16(25)8-12)10(2)20(28)29/h5-8H,1-2H2,3-4H3,(H,26,27)(H,28,29) |
| InChIKey | IVUBCHMOHYACKD-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.35 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|