C24H31BrF2N4O3 — CID 51034140
3-amino-N-[4-[[3-amino-4-(2,5-difluorophenyl)butanoyl]amino]butyl]-4-(4-bromophenyl)-2-hydroxybutanamide (PubChem CID 51034140) has the molecular formula C24H31BrF2N4O3 and a molecular weight of 541.44 g/mol. Its IUPAC name is 3-amino-N-[4-[[3-amino-4-(2,5-difluorophenyl)butanoyl]amino]butyl]-4-(4-bromophenyl)-2-hydroxybutanamide.
| Compound Name | 3-amino-N-[4-[[3-amino-4-(2,5-difluorophenyl)butanoyl]amino]butyl]-4-(4-bromophenyl)-2-hydroxybutanamide |
|---|---|
| PubChem CID | 51034140 |
| Molecular Formula | C24H31BrF2N4O3 |
| Molecular Weight | 541.44 g/mol |
| Exact Mass | 540.15 |
| IUPAC Name | 3-amino-N-[4-[[3-amino-4-(2,5-difluorophenyl)butanoyl]amino]butyl]-4-(4-bromophenyl)-2-hydroxybutanamide |
| SMILES | NC(CC(=O)NCCCCNC(=O)C(O)C(N)Cc1ccc(Br)cc1)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C24H31BrF2N4O3/c25-17-5-3-15(4-6-17)11-21(29)23(33)24(34)31-10-2-1-9-30-22(32)14-19(28)13-16-12-18(26)7-8-20(16)27/h3-8,12,19,21,23,33H,1-2,9-11,13-14,28-29H2,(H,30,32)(H,31,34) |
| InChIKey | ATXVVMRMMSUBMO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|