C31H41BrF2N2O5 — CID 158763856
tert-butyl N-[(2R,3S)-1-(4-bromophenyl)-4-[[9-(2,5-difluorophenyl)-8-methyl-6-oxononyl]amino]-3-hydroxy-4-oxobutan-2-yl]carbamate (PubChem CID 158763856) has the molecular formula C31H41BrF2N2O5 and a molecular weight of 639.58 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S)-1-(4-bromophenyl)-4-[[9-(2,5-difluorophenyl)-8-methyl-6-oxononyl]amino]-3-hydroxy-4-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S)-1-(4-bromophenyl)-4-[[9-(2,5-difluorophenyl)-8-methyl-6-oxononyl]amino]-3-hydroxy-4-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 158763856 |
| Molecular Formula | C31H41BrF2N2O5 |
| Molecular Weight | 639.58 g/mol |
| Exact Mass | 638.22 |
| IUPAC Name | tert-butyl N-[(2R,3S)-1-(4-bromophenyl)-4-[[9-(2,5-difluorophenyl)-8-methyl-6-oxononyl]amino]-3-hydroxy-4-oxobutan-2-yl]carbamate |
| SMILES | CC(CC(=O)CCCCCNC(=O)[C@@H](O)[C@@H](Cc1ccc(Br)cc1)NC(=O)OC(C)(C)C)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C31H41BrF2N2O5/c1-20(16-22-19-24(33)13-14-26(22)34)17-25(37)8-6-5-7-15-35-29(39)28(38)27(36-30(40)41-31(2,3)4)18-21-9-11-23(32)12-10-21/h9-14,19-20,27-28,38H,5-8,15-18H2,1-4H3,(H,35,39)(H,36,40)/t20?,27-,28+/m1/s1 |
| InChIKey | IOZWIOOEIGPXLL-UNYBACTRSA-N |
| XLogP | 6.04 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.58 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|