C33H37BrF2N2O6 — CID 71519368
tert-butyl N-[(2S,3S,5R)-1-(4-bromophenyl)-6-[[(3S,4S)-6-fluoro-3-hydroxy-3,4-dihydro-2H-chromen-4-yl]amino]-5-[(2-fluorophenyl)methyl]-3-hydroxy-6-oxohexan-2-yl]carbamate (PubChem CID 71519368) has the molecular formula C33H37BrF2N2O6 and a molecular weight of 675.57 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S,5R)-1-(4-bromophenyl)-6-[[(3S,4S)-6-fluoro-3-hydroxy-3,4-dihydro-2H-chromen-4-yl]amino]-5-[(2-fluorophenyl)methyl]-3-hydroxy-6-oxohexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S,5R)-1-(4-bromophenyl)-6-[[(3S,4S)-6-fluoro-3-hydroxy-3,4-dihydro-2H-chromen-4-yl]amino]-5-[(2-fluorophenyl)methyl]-3-hydroxy-6-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 71519368 |
| Molecular Formula | C33H37BrF2N2O6 |
| Molecular Weight | 675.57 g/mol |
| Exact Mass | 674.18 |
| IUPAC Name | tert-butyl N-[(2S,3S,5R)-1-(4-bromophenyl)-6-[[(3S,4S)-6-fluoro-3-hydroxy-3,4-dihydro-2H-chromen-4-yl]amino]-5-[(2-fluorophenyl)methyl]-3-hydroxy-6-oxohexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(Br)cc1)[C@@H](O)C[C@@H](Cc1ccccc1F)C(=O)N[C@H]1c2cc(F)ccc2OC[C@H]1O |
| InChI | InChI=1S/C33H37BrF2N2O6/c1-33(2,3)44-32(42)37-26(14-19-8-10-22(34)11-9-19)27(39)16-21(15-20-6-4-5-7-25(20)36)31(41)38-30-24-17-23(35)12-13-29(24)43-18-28(30)40/h4-13,17,21,26-28,30,39-40H,14-16,18H2,1-3H3,(H,37,42)(H,38,41)/t21-,26+,27+,28-,30+/m1/s1 |
| InChIKey | VPMLBUUTAJKKKE-UAVBNKATSA-N |
| XLogP | 5.38 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.57 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |