C18H29F2N3O2 — CID 58075986
tert-butyl N-[1-(4-aminobutylamino)-3-(2,5-difluorophenyl)propan-2-yl]carbamate (PubChem CID 58075986) has the molecular formula C18H29F2N3O2 and a molecular weight of 357.45 g/mol. Its IUPAC name is tert-butyl N-[1-(4-aminobutylamino)-3-(2,5-difluorophenyl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(4-aminobutylamino)-3-(2,5-difluorophenyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 58075986 |
| Molecular Formula | C18H29F2N3O2 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | tert-butyl N-[1-(4-aminobutylamino)-3-(2,5-difluorophenyl)propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CNCCCCN)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C18H29F2N3O2/c1-18(2,3)25-17(24)23-15(12-22-9-5-4-8-21)11-13-10-14(19)6-7-16(13)20/h6-7,10,15,22H,4-5,8-9,11-12,21H2,1-3H3,(H,23,24) |
| InChIKey | SAMVKSFSDJVZKJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|