C31H40FN5O4S — CID 51035482
2-[[4-[2-(dimethylamino)ethylcarbamoyl]cyclohexyl]amino]-4-(8-fluoro-3,3-dimethyl-1,1-dioxo-2,4-dihydrothiazino[2,3-a]indol-5-yl)benzamide (PubChem CID 51035482) has the molecular formula C31H40FN5O4S and a molecular weight of 597.76 g/mol. Its IUPAC name is 2-[[4-[2-(dimethylamino)ethylcarbamoyl]cyclohexyl]amino]-4-(8-fluoro-3,3-dimethyl-1,1-dioxo-2,4-dihydrothiazino[2,3-a]indol-5-yl)benzamide.
| Compound Name | 2-[[4-[2-(dimethylamino)ethylcarbamoyl]cyclohexyl]amino]-4-(8-fluoro-3,3-dimethyl-1,1-dioxo-2,4-dihydrothiazino[2,3-a]indol-5-yl)benzamide |
|---|---|
| PubChem CID | 51035482 |
| Molecular Formula | C31H40FN5O4S |
| Molecular Weight | 597.76 g/mol |
| Exact Mass | 597.28 |
| IUPAC Name | 2-[[4-[2-(dimethylamino)ethylcarbamoyl]cyclohexyl]amino]-4-(8-fluoro-3,3-dimethyl-1,1-dioxo-2,4-dihydrothiazino[2,3-a]indol-5-yl)benzamide |
| SMILES | CN(C)CCNC(=O)C1CCC(Nc2cc(-c3c4n(c5cc(F)ccc35)S(=O)(=O)CC(C)(C)C4)ccc2C(N)=O)CC1 |
| InChI | InChI=1S/C31H40FN5O4S/c1-31(2)17-27-28(24-12-8-21(32)16-26(24)37(27)42(40,41)18-31)20-7-11-23(29(33)38)25(15-20)35-22-9-5-19(6-10-22)30(39)34-13-14-36(3)4/h7-8,11-12,15-16,19,22,35H,5-6,9-10,13-14,17-18H2,1-4H3,(H2,33,38)(H,34,39) |
| InChIKey | WTBNBFUJEHHPIX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 126.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.76 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |