C33H44FN5O5S — CID 51036116
[4-[2-carbamoyl-5-(3,3-diethyl-8-fluoro-1,1-dioxo-2,4-dihydrothiazino[2,3-a]indol-5-yl)anilino]cyclohexyl] N-[2-(dimethylamino)ethyl]carbamate (PubChem CID 51036116) has the molecular formula C33H44FN5O5S and a molecular weight of 641.81 g/mol. Its IUPAC name is [4-[2-carbamoyl-5-(3,3-diethyl-8-fluoro-1,1-dioxo-2,4-dihydrothiazino[2,3-a]indol-5-yl)anilino]cyclohexyl] N-[2-(dimethylamino)ethyl]carbamate.
| Compound Name | [4-[2-carbamoyl-5-(3,3-diethyl-8-fluoro-1,1-dioxo-2,4-dihydrothiazino[2,3-a]indol-5-yl)anilino]cyclohexyl] N-[2-(dimethylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 51036116 |
| Molecular Formula | C33H44FN5O5S |
| Molecular Weight | 641.81 g/mol |
| Exact Mass | 641.30 |
| IUPAC Name | [4-[2-carbamoyl-5-(3,3-diethyl-8-fluoro-1,1-dioxo-2,4-dihydrothiazino[2,3-a]indol-5-yl)anilino]cyclohexyl] N-[2-(dimethylamino)ethyl]carbamate |
| SMILES | CCC1(CC)Cc2c(-c3ccc(C(N)=O)c(NC4CCC(OC(=O)NCCN(C)C)CC4)c3)c3ccc(F)cc3n2S(=O)(=O)C1 |
| InChI | InChI=1S/C33H44FN5O5S/c1-5-33(6-2)19-29-30(26-14-8-22(34)18-28(26)39(29)45(42,43)20-33)21-7-13-25(31(35)40)27(17-21)37-23-9-11-24(12-10-23)44-32(41)36-15-16-38(3)4/h7-8,13-14,17-18,23-24,37H,5-6,9-12,15-16,19-20H2,1-4H3,(H2,35,40)(H,36,41) |
| InChIKey | KABSOHMQENKXRO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 135.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.81 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |