C26H25F3N6O — CID 51036333
4-[4-(4-aminophenyl)-2-pyridinyl]-1-methyl-3-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]imidazol-2-one (PubChem CID 51036333) has the molecular formula C26H25F3N6O and a molecular weight of 494.52 g/mol. Its IUPAC name is 4-[4-(4-aminophenyl)-2-pyridinyl]-1-methyl-3-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]imidazol-2-one.
| Compound Name | 4-[4-(4-aminophenyl)-2-pyridinyl]-1-methyl-3-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]imidazol-2-one |
|---|---|
| PubChem CID | 51036333 |
| Molecular Formula | C26H25F3N6O |
| Molecular Weight | 494.52 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 4-[4-(4-aminophenyl)-2-pyridinyl]-1-methyl-3-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]imidazol-2-one |
| SMILES | Cn1cc(-c2cc(-c3ccc(N)cc3)ccn2)n(-c2ccc(N3CCNCC3)c(C(F)(F)F)c2)c1=O |
| InChI | InChI=1S/C26H25F3N6O/c1-33-16-24(22-14-18(8-9-32-22)17-2-4-19(30)5-3-17)35(25(33)36)20-6-7-23(21(15-20)26(27,28)29)34-12-10-31-11-13-34/h2-9,14-16,31H,10-13,30H2,1H3 |
| InChIKey | MJSBITUWDXCWQK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 81.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|