C28H23F3N6O3S — CID 71479386
2-(6-methylsulfonyl-3-pyridinyl)-10-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrido[3,2-c][1,5]naphthyridin-9-one (PubChem CID 71479386) has the molecular formula C28H23F3N6O3S and a molecular weight of 580.59 g/mol. Its IUPAC name is 2-(6-methylsulfonyl-3-pyridinyl)-10-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrido[3,2-c][1,5]naphthyridin-9-one.
| Compound Name | 2-(6-methylsulfonyl-3-pyridinyl)-10-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrido[3,2-c][1,5]naphthyridin-9-one |
|---|---|
| PubChem CID | 71479386 |
| Molecular Formula | C28H23F3N6O3S |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 580.15 |
| IUPAC Name | 2-(6-methylsulfonyl-3-pyridinyl)-10-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrido[3,2-c][1,5]naphthyridin-9-one |
| SMILES | CS(=O)(=O)c1ccc(-c2ccc3ncc4ccc(=O)n(-c5ccc(N6CCNCC6)c(C(F)(F)F)c5)c4c3n2)cn1 |
| InChI | InChI=1S/C28H23F3N6O3S/c1-41(39,40)24-8-2-17(15-34-24)21-5-6-22-26(35-21)27-18(16-33-22)3-9-25(38)37(27)19-4-7-23(20(14-19)28(29,30)31)36-12-10-32-11-13-36/h2-9,14-16,32H,10-13H2,1H3 |
| InChIKey | SADCFKPECZSBIB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|