C24H19ClF3N3O — CID 158122612
9-chloro-1-[4-piperidin-1-yl-3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one (PubChem CID 158122612) has the molecular formula C24H19ClF3N3O and a molecular weight of 457.88 g/mol. Its IUPAC name is 9-chloro-1-[4-piperidin-1-yl-3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one.
| Compound Name | 9-chloro-1-[4-piperidin-1-yl-3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one |
|---|---|
| PubChem CID | 158122612 |
| Molecular Formula | C24H19ClF3N3O |
| Molecular Weight | 457.88 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 9-chloro-1-[4-piperidin-1-yl-3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one |
| SMILES | O=c1ccc2cnc3ccc(Cl)cc3c2n1-c1ccc(N2CCCCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H19ClF3N3O/c25-16-5-7-20-18(12-16)23-15(14-29-20)4-9-22(32)31(23)17-6-8-21(19(13-17)24(26,27)28)30-10-2-1-3-11-30/h4-9,12-14H,1-3,10-11H2 |
| InChIKey | DKYPFTRNJGSTQU-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.88 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|