C33H28F3N5O — CID 161454999
9-(1H-isoindol-5-yl)-1-[4-[(1-methylpiperidin-4-yl)amino]-3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one (PubChem CID 161454999) has the molecular formula C33H28F3N5O and a molecular weight of 567.62 g/mol. Its IUPAC name is 9-(1H-isoindol-5-yl)-1-[4-[(1-methylpiperidin-4-yl)amino]-3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one.
| Compound Name | 9-(1H-isoindol-5-yl)-1-[4-[(1-methylpiperidin-4-yl)amino]-3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one |
|---|---|
| PubChem CID | 161454999 |
| Molecular Formula | C33H28F3N5O |
| Molecular Weight | 567.62 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | 9-(1H-isoindol-5-yl)-1-[4-[(1-methylpiperidin-4-yl)amino]-3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one |
| SMILES | CN1CCC(Nc2ccc(-n3c(=O)ccc4cnc5ccc(-c6ccc7c(c6)C=NC7)cc5c43)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C33H28F3N5O/c1-40-12-10-25(11-13-40)39-30-8-6-26(16-28(30)33(34,35)36)41-31(42)9-5-23-19-38-29-7-4-21(15-27(29)32(23)41)20-2-3-22-17-37-18-24(22)14-20/h2-9,14-16,18-19,25,39H,10-13,17H2,1H3 |
| InChIKey | ZGJLHRZJZBLLKC-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.62 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|