C27H22F3N9O — CID 123137124
9-(2-isocyanopyrimidin-5-yl)-3-methyl-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]-4H-pyrimido[5,4-c][1,5]naphthyridin-2-one (PubChem CID 123137124) has the molecular formula C27H22F3N9O and a molecular weight of 545.53 g/mol. Its IUPAC name is 9-(2-isocyanopyrimidin-5-yl)-3-methyl-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]-4H-pyrimido[5,4-c][1,5]naphthyridin-2-one.
| Compound Name | 9-(2-isocyanopyrimidin-5-yl)-3-methyl-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]-4H-pyrimido[5,4-c][1,5]naphthyridin-2-one |
|---|---|
| PubChem CID | 123137124 |
| Molecular Formula | C27H22F3N9O |
| Molecular Weight | 545.53 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | 9-(2-isocyanopyrimidin-5-yl)-3-methyl-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]-4H-pyrimido[5,4-c][1,5]naphthyridin-2-one |
| SMILES | [C-]#[N+]c1ncc(-c2ccc3ncc4c(c3n2)N(c2ccc(N3CCNCC3)c(C(F)(F)F)c2)C(=O)N(C)C4)cn1 |
| InChI | InChI=1S/C27H22F3N9O/c1-31-25-34-12-16(13-35-25)20-4-5-21-23(36-20)24-17(14-33-21)15-37(2)26(40)39(24)18-3-6-22(19(11-18)27(28,29)30)38-9-7-32-8-10-38/h3-6,11-14,32H,7-10,15H2,2H3 |
| InChIKey | UBKQKRVTISYTPE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|