C23H22F3N5O — CID 154362788
3-ethyl-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-2-one (PubChem CID 154362788) has the molecular formula C23H22F3N5O and a molecular weight of 441.46 g/mol. Its IUPAC name is 3-ethyl-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-2-one.
| Compound Name | 3-ethyl-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-2-one |
|---|---|
| PubChem CID | 154362788 |
| Molecular Formula | C23H22F3N5O |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 3-ethyl-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-2-one |
| SMILES | CCn1c(=O)n(-c2ccc(N3CCNCC3)c(C(F)(F)F)c2)c2c3ccccc3ncc21 |
| InChI | InChI=1S/C23H22F3N5O/c1-2-30-20-14-28-18-6-4-3-5-16(18)21(20)31(22(30)32)15-7-8-19(17(13-15)23(24,25)26)29-11-9-27-10-12-29/h3-8,13-14,27H,2,9-12H2,1H3 |
| InChIKey | HTKIIHQFDCWKMW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|