C29H29F3N6O2 — CID 166707898
8-[(2E,4E)-5-methoxy-5-(methylideneamino)penta-2,4-dien-2-yl]-3-methyl-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-2-one (PubChem CID 166707898) has the molecular formula C29H29F3N6O2 and a molecular weight of 550.59 g/mol. Its IUPAC name is 8-[(2E,4E)-5-methoxy-5-(methylideneamino)penta-2,4-dien-2-yl]-3-methyl-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-2-one.
| Compound Name | 8-[(2E,4E)-5-methoxy-5-(methylideneamino)penta-2,4-dien-2-yl]-3-methyl-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-2-one |
|---|---|
| PubChem CID | 166707898 |
| Molecular Formula | C29H29F3N6O2 |
| Molecular Weight | 550.59 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | 8-[(2E,4E)-5-methoxy-5-(methylideneamino)penta-2,4-dien-2-yl]-3-methyl-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-2-one |
| SMILES | C=N/C(=C\C=C(/C)c1ccc2ncc3c(c2c1)n(-c1ccc(N2CCNCC2)c(C(F)(F)F)c1)c(=O)n3C)OC |
| InChI | InChI=1S/C29H29F3N6O2/c1-18(5-10-26(33-2)40-4)19-6-8-23-21(15-19)27-25(17-35-23)36(3)28(39)38(27)20-7-9-24(22(16-20)29(30,31)32)37-13-11-34-12-14-37/h5-10,15-17,34H,2,11-14H2,1,3-4H3/b18-5+,26-10+ |
| InChIKey | HLZGGXGIZQYFDA-ASFIJWDYSA-N |
| XLogP | 4.90 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.59 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|