C26H37N3O4S — CID 51037977
4-(3,3-dimethyl-1,1-dioxo-2,4,5a,6,7,8,9,9a-octahydrothiopyrano[3,2-b]indol-5-yl)-2-[(4-hydroxycyclohexyl)amino]benzamide (PubChem CID 51037977) has the molecular formula C26H37N3O4S and a molecular weight of 487.67 g/mol. Its IUPAC name is 4-(3,3-dimethyl-1,1-dioxo-2,4,5a,6,7,8,9,9a-octahydrothiopyrano[3,2-b]indol-5-yl)-2-[(4-hydroxycyclohexyl)amino]benzamide.
| Compound Name | 4-(3,3-dimethyl-1,1-dioxo-2,4,5a,6,7,8,9,9a-octahydrothiopyrano[3,2-b]indol-5-yl)-2-[(4-hydroxycyclohexyl)amino]benzamide |
|---|---|
| PubChem CID | 51037977 |
| Molecular Formula | C26H37N3O4S |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | 4-(3,3-dimethyl-1,1-dioxo-2,4,5a,6,7,8,9,9a-octahydrothiopyrano[3,2-b]indol-5-yl)-2-[(4-hydroxycyclohexyl)amino]benzamide |
| SMILES | CC1(C)CC2=C(C3CCCCC3N2c2ccc(C(N)=O)c(NC3CCC(O)CC3)c2)S(=O)(=O)C1 |
| InChI | InChI=1S/C26H37N3O4S/c1-26(2)14-23-24(34(32,33)15-26)20-5-3-4-6-22(20)29(23)17-9-12-19(25(27)31)21(13-17)28-16-7-10-18(30)11-8-16/h9,12-13,16,18,20,22,28,30H,3-8,10-11,14-15H2,1-2H3,(H2,27,31) |
| InChIKey | WONHFXNZEGEKQJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |