C15H20IN5O — CID 51039201
2-(diethylamino)-N-[[1-(4-iodophenyl)triazol-4-yl]methyl]acetamide (PubChem CID 51039201) has the molecular formula C15H20IN5O and a molecular weight of 413.26 g/mol. Its IUPAC name is 2-(diethylamino)-N-[[1-(4-iodophenyl)triazol-4-yl]methyl]acetamide.
| Compound Name | 2-(diethylamino)-N-[[1-(4-iodophenyl)triazol-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 51039201 |
| Molecular Formula | C15H20IN5O |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 2-(diethylamino)-N-[[1-(4-iodophenyl)triazol-4-yl]methyl]acetamide |
| SMILES | CCN(CC)CC(=O)NCc1cn(-c2ccc(I)cc2)nn1 |
| InChI | InChI=1S/C15H20IN5O/c1-3-20(4-2)11-15(22)17-9-13-10-21(19-18-13)14-7-5-12(16)6-8-14/h5-8,10H,3-4,9,11H2,1-2H3,(H,17,22) |
| InChIKey | YESZQQZRAPCPKM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|