C26H33NO3 — CID 51039526
(E)-3-(3,4-dimethoxyphenyl)-N-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-2-enamide (PubChem CID 51039526) has the molecular formula C26H33NO3 and a molecular weight of 407.55 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 51039526 |
| Molecular Formula | C26H33NO3 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2cc3c(cc2C)C(C)(C)CCC3(C)C)cc1OC |
| InChI | InChI=1S/C26H33NO3/c1-17-14-19-20(26(4,5)13-12-25(19,2)3)16-21(17)27-24(28)11-9-18-8-10-22(29-6)23(15-18)30-7/h8-11,14-16H,12-13H2,1-7H3,(H,27,28)/b11-9+ |
| InChIKey | VWKBWEPNJQVHEM-PKNBQFBNSA-N |
| XLogP | 6.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|