C17H20N2 — CID 51039568
2-(1-benzyl-5-methylpyrrolidin-2-yl)pyridine (PubChem CID 51039568) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-(1-benzyl-5-methylpyrrolidin-2-yl)pyridine.
| Compound Name | 2-(1-benzyl-5-methylpyrrolidin-2-yl)pyridine |
|---|---|
| PubChem CID | 51039568 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 2-(1-benzyl-5-methylpyrrolidin-2-yl)pyridine |
| SMILES | CC1CCC(c2ccccn2)N1Cc1ccccc1 |
| InChI | InChI=1S/C17H20N2/c1-14-10-11-17(16-9-5-6-12-18-16)19(14)13-15-7-3-2-4-8-15/h2-9,12,14,17H,10-11,13H2,1H3 |
| InChIKey | VDQSUFJUNNMQGL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |