C10H16O4S — CID 51039895
[(3aR,6S,6aS)-2,2,6-trimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl] acetate (PubChem CID 51039895) has the molecular formula C10H16O4S and a molecular weight of 232.30 g/mol. Its IUPAC name is [(3aR,6S,6aS)-2,2,6-trimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl] acetate.
| Compound Name | [(3aR,6S,6aS)-2,2,6-trimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl] acetate |
|---|---|
| PubChem CID | 51039895 |
| Molecular Formula | C10H16O4S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | [(3aR,6S,6aS)-2,2,6-trimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl] acetate |
| SMILES | CC(=O)OC1S[C@@H](C)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C10H16O4S/c1-5-7-8(14-10(3,4)13-7)9(15-5)12-6(2)11/h5,7-9H,1-4H3/t5-,7+,8+,9?/m0/s1 |
| InChIKey | UESVUWICVWUONC-QDTXWCQISA-N |
| XLogP | 1.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |