C15H22O8S — CID 6420469
[2-acetyloxy-2-(6-acetylsulfanyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)ethyl] acetate (PubChem CID 6420469) has the molecular formula C15H22O8S and a molecular weight of 362.40 g/mol. Its IUPAC name is [2-acetyloxy-2-(6-acetylsulfanyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)ethyl] acetate.
| Compound Name | [2-acetyloxy-2-(6-acetylsulfanyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)ethyl] acetate |
|---|---|
| PubChem CID | 6420469 |
| Molecular Formula | C15H22O8S |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | [2-acetyloxy-2-(6-acetylsulfanyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)ethyl] acetate |
| SMILES | CC(=O)OCC(OC(C)=O)C1OC2OC(C)(C)OC2C1SC(C)=O |
| InChI | InChI=1S/C15H22O8S/c1-7(16)19-6-10(20-8(2)17)11-13(24-9(3)18)12-14(21-11)23-15(4,5)22-12/h10-14H,6H2,1-5H3 |
| InChIKey | POTGHZWJLMUJTQ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|