C20H38O2Si — CID 51040143
tert-butyl-[(1S)-1-[(2S,6S)-6-hexyloxan-2-yl]prop-2-ynoxy]-dimethylsilane (PubChem CID 51040143) has the molecular formula C20H38O2Si and a molecular weight of 338.61 g/mol. Its IUPAC name is tert-butyl-[(1S)-1-[(2S,6S)-6-hexyloxan-2-yl]prop-2-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1S)-1-[(2S,6S)-6-hexyloxan-2-yl]prop-2-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 51040143 |
| Molecular Formula | C20H38O2Si |
| Molecular Weight | 338.61 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | tert-butyl-[(1S)-1-[(2S,6S)-6-hexyloxan-2-yl]prop-2-ynoxy]-dimethylsilane |
| SMILES | C#C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CCC[C@H](CCCCCC)O1 |
| InChI | InChI=1S/C20H38O2Si/c1-8-10-11-12-14-17-15-13-16-19(21-17)18(9-2)22-23(6,7)20(3,4)5/h2,17-19H,8,10-16H2,1,3-7H3/t17-,18-,19-/m0/s1 |
| InChIKey | XJJPWQFKKWOQEN-FHWLQOOXSA-N |
| XLogP | 5.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.61 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|