C23H27F3N2O2 — CID 51040455
ethyl (4S,9S)-6-ethyl-5,5,9-trimethyl-2-phenyl-9-(trifluoromethyl)-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-3-carboxylate (PubChem CID 51040455) has the molecular formula C23H27F3N2O2 and a molecular weight of 420.48 g/mol. Its IUPAC name is ethyl (4S,9S)-6-ethyl-5,5,9-trimethyl-2-phenyl-9-(trifluoromethyl)-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-3-carboxylate.
| Compound Name | ethyl (4S,9S)-6-ethyl-5,5,9-trimethyl-2-phenyl-9-(trifluoromethyl)-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-3-carboxylate |
|---|---|
| PubChem CID | 51040455 |
| Molecular Formula | C23H27F3N2O2 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | ethyl (4S,9S)-6-ethyl-5,5,9-trimethyl-2-phenyl-9-(trifluoromethyl)-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N2N3C(=C(CC)C(C)(C)[C@@H]13)C[C@@]2(C)C(F)(F)F |
| InChI | InChI=1S/C23H27F3N2O2/c1-6-15-16-13-22(5,23(24,25)26)28-18(14-11-9-8-10-12-14)17(20(29)30-7-2)19(27(16)28)21(15,3)4/h8-12,19H,6-7,13H2,1-5H3/t19-,22+/m1/s1 |
| InChIKey | PIHRIVSHQFHLDK-KNQAVFIVSA-N |
| XLogP | 5.29 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |