C21H23F3N2O2 — CID 102207250
ethyl (4S,9S)-5,5,6-trimethyl-9-phenyl-2-(trifluoromethyl)-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-3-carboxylate (PubChem CID 102207250) has the molecular formula C21H23F3N2O2 and a molecular weight of 392.42 g/mol. Its IUPAC name is ethyl (4S,9S)-5,5,6-trimethyl-9-phenyl-2-(trifluoromethyl)-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-3-carboxylate.
| Compound Name | ethyl (4S,9S)-5,5,6-trimethyl-9-phenyl-2-(trifluoromethyl)-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-3-carboxylate |
|---|---|
| PubChem CID | 102207250 |
| Molecular Formula | C21H23F3N2O2 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | ethyl (4S,9S)-5,5,6-trimethyl-9-phenyl-2-(trifluoromethyl)-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C(F)(F)F)N2[C@H](c3ccccc3)CC3=C(C)C(C)(C)[C@@H]1N32 |
| InChI | InChI=1S/C21H23F3N2O2/c1-5-28-19(27)16-17-20(3,4)12(2)14-11-15(13-9-7-6-8-10-13)26(25(14)17)18(16)21(22,23)24/h6-10,15,17H,5,11H2,1-4H3/t15-,17+/m0/s1 |
| InChIKey | OFVAPOQMVJPZDL-DOTOQJQBSA-N |
| XLogP | 4.73 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |