C27H22ClF3N6O — CID 51041840
2-[2-[(3-chlorocyclopentyl)methoxy]phenyl]-5,6-difluoro-1-[[3-fluoro-4-(2H-tetrazol-5-yl)phenyl]methyl]benzimidazole (PubChem CID 51041840) has the molecular formula C27H22ClF3N6O and a molecular weight of 538.96 g/mol. Its IUPAC name is 2-[2-[(3-chlorocyclopentyl)methoxy]phenyl]-5,6-difluoro-1-[[3-fluoro-4-(2H-tetrazol-5-yl)phenyl]methyl]benzimidazole.
| Compound Name | 2-[2-[(3-chlorocyclopentyl)methoxy]phenyl]-5,6-difluoro-1-[[3-fluoro-4-(2H-tetrazol-5-yl)phenyl]methyl]benzimidazole |
|---|---|
| PubChem CID | 51041840 |
| Molecular Formula | C27H22ClF3N6O |
| Molecular Weight | 538.96 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | 2-[2-[(3-chlorocyclopentyl)methoxy]phenyl]-5,6-difluoro-1-[[3-fluoro-4-(2H-tetrazol-5-yl)phenyl]methyl]benzimidazole |
| SMILES | Fc1cc2nc(-c3ccccc3OCC3CCC(Cl)C3)n(Cc3ccc(-c4nn[nH]n4)c(F)c3)c2cc1F |
| InChI | InChI=1S/C27H22ClF3N6O/c28-17-7-5-16(9-17)14-38-25-4-2-1-3-19(25)27-32-23-11-21(30)22(31)12-24(23)37(27)13-15-6-8-18(20(29)10-15)26-33-35-36-34-26/h1-4,6,8,10-12,16-17H,5,7,9,13-14H2,(H,33,34,35,36) |
| InChIKey | LYVOCJUGESJRHK-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.96 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|