C28H25ClF2N6O — CID 67083024
4-chloro-1-(cyclohexylmethyl)-5,6-difluoro-2-[2-phenylmethoxy-4-(2H-tetrazol-5-yl)phenyl]benzimidazole (PubChem CID 67083024) has the molecular formula C28H25ClF2N6O and a molecular weight of 535.00 g/mol. Its IUPAC name is 4-chloro-1-(cyclohexylmethyl)-5,6-difluoro-2-[2-phenylmethoxy-4-(2H-tetrazol-5-yl)phenyl]benzimidazole.
| Compound Name | 4-chloro-1-(cyclohexylmethyl)-5,6-difluoro-2-[2-phenylmethoxy-4-(2H-tetrazol-5-yl)phenyl]benzimidazole |
|---|---|
| PubChem CID | 67083024 |
| Molecular Formula | C28H25ClF2N6O |
| Molecular Weight | 535.00 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | 4-chloro-1-(cyclohexylmethyl)-5,6-difluoro-2-[2-phenylmethoxy-4-(2H-tetrazol-5-yl)phenyl]benzimidazole |
| SMILES | Fc1cc2c(nc(-c3ccc(-c4nn[nH]n4)cc3OCc3ccccc3)n2CC2CCCCC2)c(Cl)c1F |
| InChI | InChI=1S/C28H25ClF2N6O/c29-24-25(31)21(30)14-22-26(24)32-28(37(22)15-17-7-3-1-4-8-17)20-12-11-19(27-33-35-36-34-27)13-23(20)38-16-18-9-5-2-6-10-18/h2,5-6,9-14,17H,1,3-4,7-8,15-16H2,(H,33,34,35,36) |
| InChIKey | VCCZSQZUXJNEOV-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.00 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|