C21H20N4O3 — CID 22010194
5-[2,4-bis(phenylmethoxy)phenyl]-2H-tetrazole;hydrate (PubChem CID 22010194) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is 5-[2,4-bis(phenylmethoxy)phenyl]-2H-tetrazole;hydrate.
| Compound Name | 5-[2,4-bis(phenylmethoxy)phenyl]-2H-tetrazole;hydrate |
|---|---|
| PubChem CID | 22010194 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 5-[2,4-bis(phenylmethoxy)phenyl]-2H-tetrazole;hydrate |
| SMILES | O.c1ccc(COc2ccc(-c3nn[nH]n3)c(OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C21H18N4O2.H2O/c1-3-7-16(8-4-1)14-26-18-11-12-19(21-22-24-25-23-21)20(13-18)27-15-17-9-5-2-6-10-17;/h1-13H,14-15H2,(H,22,23,24,25);1H2 |
| InChIKey | ZJUWZFFBVOSLSK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 104.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |