C26H23N5O2 — CID 57314307
2-ethyl-6-methoxy-4-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methoxy]quinoline (PubChem CID 57314307) has the molecular formula C26H23N5O2 and a molecular weight of 437.50 g/mol. Its IUPAC name is 2-ethyl-6-methoxy-4-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methoxy]quinoline.
| Compound Name | 2-ethyl-6-methoxy-4-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methoxy]quinoline |
|---|---|
| PubChem CID | 57314307 |
| Molecular Formula | C26H23N5O2 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 2-ethyl-6-methoxy-4-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methoxy]quinoline |
| SMILES | CCc1cc(OCc2ccc(-c3ccccc3)c(-c3nn[nH]n3)c2)c2cc(OC)ccc2n1 |
| InChI | InChI=1S/C26H23N5O2/c1-3-19-14-25(23-15-20(32-2)10-12-24(23)27-19)33-16-17-9-11-21(18-7-5-4-6-8-18)22(13-17)26-28-30-31-29-26/h4-15H,3,16H2,1-2H3,(H,28,29,30,31) |
| InChIKey | BMTJEXDLKRFWJV-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |