C25H21N5O2 — CID 57281004
2-(methoxymethyl)-4-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methoxy]quinoline (PubChem CID 57281004) has the molecular formula C25H21N5O2 and a molecular weight of 423.48 g/mol. Its IUPAC name is 2-(methoxymethyl)-4-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methoxy]quinoline.
| Compound Name | 2-(methoxymethyl)-4-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methoxy]quinoline |
|---|---|
| PubChem CID | 57281004 |
| Molecular Formula | C25H21N5O2 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 2-(methoxymethyl)-4-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methoxy]quinoline |
| SMILES | COCc1cc(OCc2ccc(-c3ccccc3)c(-c3nn[nH]n3)c2)c2ccccc2n1 |
| InChI | InChI=1S/C25H21N5O2/c1-31-16-19-14-24(21-9-5-6-10-23(21)26-19)32-15-17-11-12-20(18-7-3-2-4-8-18)22(13-17)25-27-29-30-28-25/h2-14H,15-16H2,1H3,(H,27,28,29,30) |
| InChIKey | KZTSHPNAHJYRRO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |