C24H20N4O3 — CID 51044215
(E)-3-(4-methoxyphenyl)-N-[2-[3-(6-methyl-3-pyridinyl)-1,2,4-oxadiazol-5-yl]phenyl]prop-2-enamide (PubChem CID 51044215) has the molecular formula C24H20N4O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is (E)-3-(4-methoxyphenyl)-N-[2-[3-(6-methyl-3-pyridinyl)-1,2,4-oxadiazol-5-yl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(4-methoxyphenyl)-N-[2-[3-(6-methyl-3-pyridinyl)-1,2,4-oxadiazol-5-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 51044215 |
| Molecular Formula | C24H20N4O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | (E)-3-(4-methoxyphenyl)-N-[2-[3-(6-methyl-3-pyridinyl)-1,2,4-oxadiazol-5-yl]phenyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccccc2-c2nc(-c3ccc(C)nc3)no2)cc1 |
| InChI | InChI=1S/C24H20N4O3/c1-16-7-11-18(15-25-16)23-27-24(31-28-23)20-5-3-4-6-21(20)26-22(29)14-10-17-8-12-19(30-2)13-9-17/h3-15H,1-2H3,(H,26,29)/b14-10+ |
| InChIKey | KRCYNNOFGQAFOP-GXDHUFHOSA-N |
| XLogP | 4.77 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|