C23H19N3O5 — CID 30332465
(E)-N-[2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 30332465) has the molecular formula C23H19N3O5 and a molecular weight of 417.42 g/mol. Its IUPAC name is (E)-N-[2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 30332465 |
| Molecular Formula | C23H19N3O5 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | (E)-N-[2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | COc1ccc(-c2noc(-c3ccccc3NC(=O)/C=C/c3ccco3)n2)cc1OC |
| InChI | InChI=1S/C23H19N3O5/c1-28-19-11-9-15(14-20(19)29-2)22-25-23(31-26-22)17-7-3-4-8-18(17)24-21(27)12-10-16-6-5-13-30-16/h3-14H,1-2H3,(H,24,27)/b12-10+ |
| InChIKey | PAMXHPLWVUXNCG-ZRDIBKRKSA-N |
| XLogP | 4.67 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|