C26H26N4O2S — CID 51045351
5-[4-[benzyl(ethyl)amino]phenyl]-2-sulfanylidene-1,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 51045351) has the molecular formula C26H26N4O2S and a molecular weight of 458.59 g/mol. Its IUPAC name is 5-[4-[benzyl(ethyl)amino]phenyl]-2-sulfanylidene-1,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 5-[4-[benzyl(ethyl)amino]phenyl]-2-sulfanylidene-1,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 51045351 |
| Molecular Formula | C26H26N4O2S |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 5-[4-[benzyl(ethyl)amino]phenyl]-2-sulfanylidene-1,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | CCN(Cc1ccccc1)c1ccc(C2C3=C(CCCC3=O)Nc3[nH]c(=S)[nH]c(=O)c32)cc1 |
| InChI | InChI=1S/C26H26N4O2S/c1-2-30(15-16-7-4-3-5-8-16)18-13-11-17(12-14-18)21-22-19(9-6-10-20(22)31)27-24-23(21)25(32)29-26(33)28-24/h3-5,7-8,11-14,21H,2,6,9-10,15H2,1H3,(H3,27,28,29,32,33) |
| InChIKey | QQEMCQOTIDCHCM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|