C22H27NO2 — CID 51045668
(E)-1-(4-butoxyphenyl)-3-(4-propan-2-ylanilino)prop-2-en-1-one (PubChem CID 51045668) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is (E)-1-(4-butoxyphenyl)-3-(4-propan-2-ylanilino)prop-2-en-1-one.
| Compound Name | (E)-1-(4-butoxyphenyl)-3-(4-propan-2-ylanilino)prop-2-en-1-one |
|---|---|
| PubChem CID | 51045668 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | (E)-1-(4-butoxyphenyl)-3-(4-propan-2-ylanilino)prop-2-en-1-one |
| SMILES | CCCCOc1ccc(C(=O)/C=C/Nc2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H27NO2/c1-4-5-16-25-21-12-8-19(9-13-21)22(24)14-15-23-20-10-6-18(7-11-20)17(2)3/h6-15,17,23H,4-5,16H2,1-3H3/b15-14+ |
| InChIKey | VBARDUOUOVYKOK-CCEZHUSRSA-N |
| XLogP | 5.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|