C21H24FNO2 — CID 71350265
3-(4-fluoroanilino)-1-(4-hexoxyphenyl)prop-2-en-1-one (PubChem CID 71350265) has the molecular formula C21H24FNO2 and a molecular weight of 341.43 g/mol. Its IUPAC name is 3-(4-fluoroanilino)-1-(4-hexoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-(4-fluoroanilino)-1-(4-hexoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 71350265 |
| Molecular Formula | C21H24FNO2 |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 3-(4-fluoroanilino)-1-(4-hexoxyphenyl)prop-2-en-1-one |
| SMILES | CCCCCCOc1ccc(C(=O)C=CNc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H24FNO2/c1-2-3-4-5-16-25-20-12-6-17(7-13-20)21(24)14-15-23-19-10-8-18(22)9-11-19/h6-15,23H,2-5,16H2,1H3 |
| InChIKey | NAHBJDWBDRXHHD-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|