C57H86N2O5 — CID 102287184
(Z)-3-[5-nonyl-4-octoxy-2-[[(Z)-3-(4-octoxyphenyl)-3-oxoprop-1-enyl]amino]anilino]-1-(4-octoxyphenyl)prop-2-en-1-one (PubChem CID 102287184) has the molecular formula C57H86N2O5 and a molecular weight of 879.32 g/mol. Its IUPAC name is (Z)-3-[5-nonyl-4-octoxy-2-[[(Z)-3-(4-octoxyphenyl)-3-oxoprop-1-enyl]amino]anilino]-1-(4-octoxyphenyl)prop-2-en-1-one.
| Compound Name | (Z)-3-[5-nonyl-4-octoxy-2-[[(Z)-3-(4-octoxyphenyl)-3-oxoprop-1-enyl]amino]anilino]-1-(4-octoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 102287184 |
| Molecular Formula | C57H86N2O5 |
| Molecular Weight | 879.32 g/mol |
| Exact Mass | 878.65 |
| IUPAC Name | (Z)-3-[5-nonyl-4-octoxy-2-[[(Z)-3-(4-octoxyphenyl)-3-oxoprop-1-enyl]amino]anilino]-1-(4-octoxyphenyl)prop-2-en-1-one |
| SMILES | CCCCCCCCCc1cc(N/C=C\C(=O)c2ccc(OCCCCCCCC)cc2)c(N/C=C\C(=O)c2ccc(OCCCCCCCC)cc2)cc1OCCCCCCCC |
| InChI | InChI=1S/C57H86N2O5/c1-5-9-13-17-21-22-26-30-50-46-53(58-41-39-55(60)48-31-35-51(36-32-48)62-43-27-23-18-14-10-6-2)54(47-57(50)64-45-29-25-20-16-12-8-4)59-42-40-56(61)49-33-37-52(38-34-49)63-44-28-24-19-15-11-7-3/h31-42,46-47,58-59H,5-30,43-45H2,1-4H3/b41-39-,42-40- |
| InChIKey | KJUKTMSOTAATCY-FSVNFQGMSA-N |
| XLogP | 16.81 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.32 |
| LogP ≤ 5 | 16.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|