C80H132N2O10 — CID 101190737
(E)-3-[4,5-dioctoxy-2-[[(E)-3-oxo-3-(2,4,5-trioctoxyphenyl)prop-1-enyl]amino]anilino]-1-(2-hydroxy-4,5-dioctoxyphenyl)prop-2-en-1-one (PubChem CID 101190737) has the molecular formula C80H132N2O10 and a molecular weight of 1281.94 g/mol. Its IUPAC name is (E)-3-[4,5-dioctoxy-2-[[(E)-3-oxo-3-(2,4,5-trioctoxyphenyl)prop-1-enyl]amino]anilino]-1-(2-hydroxy-4,5-dioctoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[4,5-dioctoxy-2-[[(E)-3-oxo-3-(2,4,5-trioctoxyphenyl)prop-1-enyl]amino]anilino]-1-(2-hydroxy-4,5-dioctoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 101190737 |
| Molecular Formula | C80H132N2O10 |
| Molecular Weight | 1281.94 g/mol |
| Exact Mass | 1280.99 |
| IUPAC Name | (E)-3-[4,5-dioctoxy-2-[[(E)-3-oxo-3-(2,4,5-trioctoxyphenyl)prop-1-enyl]amino]anilino]-1-(2-hydroxy-4,5-dioctoxyphenyl)prop-2-en-1-one |
| SMILES | CCCCCCCCOc1cc(O)c(C(=O)/C=C/Nc2cc(OCCCCCCCC)c(OCCCCCCCC)cc2N/C=C/C(=O)c2cc(OCCCCCCCC)c(OCCCCCCCC)cc2OCCCCCCCC)cc1OCCCCCCCC |
| InChI | InChI=1S/C80H132N2O10/c1-8-15-22-29-36-43-54-86-74-66-80(92-60-49-42-35-28-21-14-7)76(88-56-45-38-31-24-17-10-3)62-68(74)72(84)51-53-82-70-64-78(90-58-47-40-33-26-19-12-5)77(89-57-46-39-32-25-18-11-4)63-69(70)81-52-50-71(83)67-61-75(87-55-44-37-30-23-16-9-2)79(65-73(67)85)91-59-48-41-34-27-20-13-6/h50-53,61-66,81-82,85H,8-49,54-60H2,1-7H3/b52-50+,53-51+ |
| InChIKey | YDMYAQKBGNFASF-NMWXCNFPSA-N |
| XLogP | 24.18 |
| TPSA | 143.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 64 |
| Heavy Atoms | 92 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1281.94 |
| LogP ≤ 5 | 24.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|