C22H26N2O — CID 51045978
(E)-1-(2,5-dimethylphenyl)-3-[3-(pyrrolidin-1-ylmethyl)anilino]prop-2-en-1-one (PubChem CID 51045978) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is (E)-1-(2,5-dimethylphenyl)-3-[3-(pyrrolidin-1-ylmethyl)anilino]prop-2-en-1-one.
| Compound Name | (E)-1-(2,5-dimethylphenyl)-3-[3-(pyrrolidin-1-ylmethyl)anilino]prop-2-en-1-one |
|---|---|
| PubChem CID | 51045978 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | (E)-1-(2,5-dimethylphenyl)-3-[3-(pyrrolidin-1-ylmethyl)anilino]prop-2-en-1-one |
| SMILES | Cc1ccc(C)c(C(=O)/C=C/Nc2cccc(CN3CCCC3)c2)c1 |
| InChI | InChI=1S/C22H26N2O/c1-17-8-9-18(2)21(14-17)22(25)10-11-23-20-7-5-6-19(15-20)16-24-12-3-4-13-24/h5-11,14-15,23H,3-4,12-13,16H2,1-2H3/b11-10+ |
| InChIKey | QZNBFJRQZQTGBJ-ZHACJKMWSA-N |
| XLogP | 4.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|