C17H16ClNO — CID 51045999
(E)-3-(4-chloroanilino)-1-(2,5-dimethylphenyl)prop-2-en-1-one (PubChem CID 51045999) has the molecular formula C17H16ClNO and a molecular weight of 285.77 g/mol. Its IUPAC name is (E)-3-(4-chloroanilino)-1-(2,5-dimethylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-chloroanilino)-1-(2,5-dimethylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 51045999 |
| Molecular Formula | C17H16ClNO |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | (E)-3-(4-chloroanilino)-1-(2,5-dimethylphenyl)prop-2-en-1-one |
| SMILES | Cc1ccc(C)c(C(=O)/C=C/Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C17H16ClNO/c1-12-3-4-13(2)16(11-12)17(20)9-10-19-15-7-5-14(18)6-8-15/h3-11,19H,1-2H3/b10-9+ |
| InChIKey | YZKOUPAESAHMAK-MDZDMXLPSA-N |
| XLogP | 4.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|