C14H19NO3 — CID 51050399
(2S,3S,4R)-1-benzyl-2-(hydroxymethyl)-5-methylidenepiperidine-3,4-diol (PubChem CID 51050399) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is (2S,3S,4R)-1-benzyl-2-(hydroxymethyl)-5-methylidenepiperidine-3,4-diol.
| Compound Name | (2S,3S,4R)-1-benzyl-2-(hydroxymethyl)-5-methylidenepiperidine-3,4-diol |
|---|---|
| PubChem CID | 51050399 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | (2S,3S,4R)-1-benzyl-2-(hydroxymethyl)-5-methylidenepiperidine-3,4-diol |
| SMILES | C=C1CN(Cc2ccccc2)[C@@H](CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H19NO3/c1-10-7-15(8-11-5-3-2-4-6-11)12(9-16)14(18)13(10)17/h2-6,12-14,16-18H,1,7-9H2/t12-,13+,14-/m0/s1 |
| InChIKey | KDQKUAXVICOYRZ-MJBXVCDLSA-N |
| XLogP | 0.14 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|