C23H22N4 — CID 51050722
N-(2,6-dimethylphenyl)-1-[6-(1-methylbenzimidazol-2-yl)-2-pyridinyl]ethanimine (PubChem CID 51050722) has the molecular formula C23H22N4 and a molecular weight of 354.46 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-1-[6-(1-methylbenzimidazol-2-yl)-2-pyridinyl]ethanimine.
| Compound Name | N-(2,6-dimethylphenyl)-1-[6-(1-methylbenzimidazol-2-yl)-2-pyridinyl]ethanimine |
|---|---|
| PubChem CID | 51050722 |
| Molecular Formula | C23H22N4 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | N-(2,6-dimethylphenyl)-1-[6-(1-methylbenzimidazol-2-yl)-2-pyridinyl]ethanimine |
| SMILES | C/C(=N\c1c(C)cccc1C)c1cccc(-c2nc3ccccc3n2C)n1 |
| InChI | InChI=1S/C23H22N4/c1-15-9-7-10-16(2)22(15)24-17(3)18-12-8-13-20(25-18)23-26-19-11-5-6-14-21(19)27(23)4/h5-14H,1-4H3/b24-17+ |
| InChIKey | ITOGEPXEQNZPSO-JJIBRWJFSA-N |
| XLogP | 5.39 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|