C38H54O2 — CID 51052190
[(3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2E,4E)-5-phenylpenta-2,4-dienoate (PubChem CID 51052190) has the molecular formula C38H54O2 and a molecular weight of 542.85 g/mol. Its IUPAC name is [(3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2E,4E)-5-phenylpenta-2,4-dienoate.
| Compound Name | [(3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2E,4E)-5-phenylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 51052190 |
| Molecular Formula | C38H54O2 |
| Molecular Weight | 542.85 g/mol |
| Exact Mass | 542.41 |
| IUPAC Name | [(3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2E,4E)-5-phenylpenta-2,4-dienoate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2C3CC=C4C[C@@H](OC(=O)/C=C/C=C/c5ccccc5)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C38H54O2/c1-27(2)12-11-13-28(3)33-20-21-34-32-19-18-30-26-31(22-24-37(30,4)35(32)23-25-38(33,34)5)40-36(39)17-10-9-16-29-14-7-6-8-15-29/h6-10,14-18,27-28,31-35H,11-13,19-26H2,1-5H3/b16-9+,17-10+/t28-,31+,32?,33-,34?,35?,37+,38-/m1/s1 |
| InChIKey | ZQWQUQIGDLYSOC-FTVQGQTDSA-N |
| XLogP | 10.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.85 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|